C14H22O — CID 11805885
(1S,5S)-4,4,8-trimethyltricyclo[3.3.3.01,5]undecan-2-one (PubChem CID 11805885) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (1S,5S)-4,4,8-trimethyltricyclo[3.3.3.01,5]undecan-2-one.
| Compound Name | (1S,5S)-4,4,8-trimethyltricyclo[3.3.3.01,5]undecan-2-one |
|---|---|
| PubChem CID | 11805885 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (1S,5S)-4,4,8-trimethyltricyclo[3.3.3.01,5]undecan-2-one |
| SMILES | CC1CC[C@]23CCC[C@]12C(=O)CC3(C)C |
| InChI | InChI=1S/C14H22O/c1-10-5-8-13-6-4-7-14(10,13)11(15)9-12(13,2)3/h10H,4-9H2,1-3H3/t10?,13-,14+/m0/s1 |
| InChIKey | CNYPBJDMBFBJHS-INPHSSGZSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |