C14H22O — CID 11790397
(1R,5S,7S,10R)-5,7,10-trimethyltricyclo[5.3.1.01,5]undecan-11-one (PubChem CID 11790397) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (1R,5S,7S,10R)-5,7,10-trimethyltricyclo[5.3.1.01,5]undecan-11-one.
| Compound Name | (1R,5S,7S,10R)-5,7,10-trimethyltricyclo[5.3.1.01,5]undecan-11-one |
|---|---|
| PubChem CID | 11790397 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (1R,5S,7S,10R)-5,7,10-trimethyltricyclo[5.3.1.01,5]undecan-11-one |
| SMILES | C[C@@H]1CC[C@@]2(C)C[C@]3(C)CCC[C@@]13C2=O |
| InChI | InChI=1S/C14H22O/c1-10-5-8-12(2)9-13(3)6-4-7-14(10,13)11(12)15/h10H,4-9H2,1-3H3/t10-,12+,13+,14+/m1/s1 |
| InChIKey | ZMMYCTDOODEMGX-SAXRGWBVSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |