C17H14O4 — CID 10401495
heptacyclo[7.6.2.01,9.03,7.03,13.07,12.010,15]heptadecane-2,8,11,14-tetrone (PubChem CID 10401495) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is heptacyclo[7.6.2.01,9.03,7.03,13.07,12.010,15]heptadecane-2,8,11,14-tetrone.
| Compound Name | heptacyclo[7.6.2.01,9.03,7.03,13.07,12.010,15]heptadecane-2,8,11,14-tetrone |
|---|---|
| PubChem CID | 10401495 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | heptacyclo[7.6.2.01,9.03,7.03,13.07,12.010,15]heptadecane-2,8,11,14-tetrone |
| SMILES | O=C1C2C3C(=O)C4C1C15CCC41C(=O)C31CCCC21C5=O |
| InChI | InChI=1S/C17H14O4/c18-10-6-7-11(19)9-8(10)16-4-5-17(9,16)13(21)15(7)3-1-2-14(6,15)12(16)20/h6-9H,1-5H2 |
| InChIKey | VJDJXWOIXWGSLT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |