C12H10Br4O2 — CID 14968549
(1R,4S,6R,9S)-1,4,6,9-tetrabromotetracyclo[7.2.1.04,11.06,10]dodecane-5,12-dione (PubChem CID 14968549) has the molecular formula C12H10Br4O2 and a molecular weight of 505.83 g/mol. Its IUPAC name is (1R,4S,6R,9S)-1,4,6,9-tetrabromotetracyclo[7.2.1.04,11.06,10]dodecane-5,12-dione.
| Compound Name | (1R,4S,6R,9S)-1,4,6,9-tetrabromotetracyclo[7.2.1.04,11.06,10]dodecane-5,12-dione |
|---|---|
| PubChem CID | 14968549 |
| Molecular Formula | C12H10Br4O2 |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 501.74 |
| IUPAC Name | (1R,4S,6R,9S)-1,4,6,9-tetrabromotetracyclo[7.2.1.04,11.06,10]dodecane-5,12-dione |
| SMILES | O=C1[C@]2(Br)CC[C@]3(Br)C(=O)[C@]4(Br)CC[C@@]1(Br)C4C23 |
| InChI | InChI=1S/C12H10Br4O2/c13-9-1-2-10(14)5(9)6-11(15,7(9)17)3-4-12(6,16)8(10)18/h5-6H,1-4H2/t5?,6?,9-,10+,11+,12- |
| InChIKey | JJXNGNLGGBRBAD-ARAPJZHZSA-N |
| XLogP | 3.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|