C20H24Br4O2 — CID 98135521
(1R,4R,7S)-1,7-dibromo-4-[(E)-2-[(1R,4S,7R)-4,7-dibromo-2,2-dimethyl-3-oxo-1-bicyclo[2.2.1]heptanyl]ethenyl]-3,3-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 98135521) has the molecular formula C20H24Br4O2 and a molecular weight of 616.03 g/mol. Its IUPAC name is (1R,4R,7S)-1,7-dibromo-4-[(E)-2-[(1R,4S,7R)-4,7-dibromo-2,2-dimethyl-3-oxo-1-bicyclo[2.2.1]heptanyl]ethenyl]-3,3-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,4R,7S)-1,7-dibromo-4-[(E)-2-[(1R,4S,7R)-4,7-dibromo-2,2-dimethyl-3-oxo-1-bicyclo[2.2.1]heptanyl]ethenyl]-3,3-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 98135521 |
| Molecular Formula | C20H24Br4O2 |
| Molecular Weight | 616.03 g/mol |
| Exact Mass | 611.85 |
| IUPAC Name | (1R,4R,7S)-1,7-dibromo-4-[(E)-2-[(1R,4S,7R)-4,7-dibromo-2,2-dimethyl-3-oxo-1-bicyclo[2.2.1]heptanyl]ethenyl]-3,3-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C(=O)[C@]2(Br)CC[C@]1(/C=C/[C@]13CC[C@](Br)(C(=O)C1(C)C)[C@@H]3Br)[C@@H]2Br |
| InChI | InChI=1S/C20H24Br4O2/c1-15(2)13(25)19(23)9-7-17(15,11(19)21)5-6-18-8-10-20(24,12(18)22)14(26)16(18,3)4/h5-6,11-12H,7-10H2,1-4H3/b6-5+/t11-,12+,17-,18-,19-,20+/m1/s1 |
| InChIKey | KCHBNJFXKOPVID-FIZGZBGSSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.03 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|