C10H16Br2O — CID 10924994
2,3-dibromo-2,6,6-trimethylcyclohexane-1-carbaldehyde (PubChem CID 10924994) has the molecular formula C10H16Br2O and a molecular weight of 312.05 g/mol. Its IUPAC name is 2,3-dibromo-2,6,6-trimethylcyclohexane-1-carbaldehyde.
| Compound Name | 2,3-dibromo-2,6,6-trimethylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 10924994 |
| Molecular Formula | C10H16Br2O |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 2,3-dibromo-2,6,6-trimethylcyclohexane-1-carbaldehyde |
| SMILES | CC1(C)CCC(Br)C(C)(Br)C1C=O |
| InChI | InChI=1S/C10H16Br2O/c1-9(2)5-4-8(11)10(3,12)7(9)6-13/h6-8H,4-5H2,1-3H3 |
| InChIKey | UFQFRDDBFNWLCU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|