C10H18O — CID 138734461
2,2-dimethylcycloheptane-1-carbaldehyde (PubChem CID 138734461) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 2,2-dimethylcycloheptane-1-carbaldehyde.
| Compound Name | 2,2-dimethylcycloheptane-1-carbaldehyde |
|---|---|
| PubChem CID | 138734461 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 2,2-dimethylcycloheptane-1-carbaldehyde |
| SMILES | CC1(C)CCCCCC1C=O |
| InChI | InChI=1S/C10H18O/c1-10(2)7-5-3-4-6-9(10)8-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | PTBOHNVLIIWXCR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|