About (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde
(5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde (PubChem CID 168911046) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde.
Molecular Properties
| Compound Name | (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde |
| PubChem CID | 168911046 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde |
| SMILES | O=C[C@H]1CCCCC12OCO2 |
| InChI | InChI=1S/C8H12O3/c9-5-7-3-1-2-4-8(7)10-6-11-8/h5,7H,1-4,6H2/t7-/m1/s1 |
| InChIKey | IPBYCCPYALAILW-SSDOTTSWSA-N |
| XLogP | 1.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde?
The IUPAC name of (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde (CID 168911046) is (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde.
What is the SMILES notation for (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde?
The canonical SMILES for (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde is O=C[C@H]1CCCCC12OCO2.
What is the InChIKey of (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde?
The InChIKey is IPBYCCPYALAILW-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H12O3/c9-5-7-3-1-2-4-8(7)10-6-11-8/h5,7H,1-4,6H2/t7-/m1/s1.
What are the key properties of (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde?
(5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde has a molecular weight of 156.18 g/mol, XLogP of 1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1,3-dioxaspiro[3.5]nonane-5-carbaldehyde is sourced from PubChem (CID 168911046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).