C10H12Br2O2 — CID 98469687
(1R,4S,7S)-4,7-dibromo-2,2-dimethyl-3-oxobicyclo[2.2.1]heptane-1-carbaldehyde (PubChem CID 98469687) has the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. Its IUPAC name is (1R,4S,7S)-4,7-dibromo-2,2-dimethyl-3-oxobicyclo[2.2.1]heptane-1-carbaldehyde.
| Compound Name | (1R,4S,7S)-4,7-dibromo-2,2-dimethyl-3-oxobicyclo[2.2.1]heptane-1-carbaldehyde |
|---|---|
| PubChem CID | 98469687 |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | (1R,4S,7S)-4,7-dibromo-2,2-dimethyl-3-oxobicyclo[2.2.1]heptane-1-carbaldehyde |
| SMILES | CC1(C)C(=O)[C@@]2(Br)CC[C@@]1(C=O)[C@@H]2Br |
| InChI | InChI=1S/C10H12Br2O2/c1-8(2)7(14)10(12)4-3-9(8,5-13)6(10)11/h5-6H,3-4H2,1-2H3/t6-,9+,10+/m0/s1 |
| InChIKey | BHBBKYJAFTZJJA-WQGWLQIFSA-N |
| XLogP | 2.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|