C11H17OTl — CID 58520954
[(4S,5R)-1-formyl-4,6,6-trimethyl-5-bicyclo[2.1.1]hexanyl]methylthallium (PubChem CID 58520954) has the molecular formula C11H17OTl and a molecular weight of 369.64 g/mol. Its IUPAC name is [(4S,5R)-1-formyl-4,6,6-trimethyl-5-bicyclo[2.1.1]hexanyl]methylthallium.
| Compound Name | [(4S,5R)-1-formyl-4,6,6-trimethyl-5-bicyclo[2.1.1]hexanyl]methylthallium |
|---|---|
| PubChem CID | 58520954 |
| Molecular Formula | C11H17OTl |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | [(4S,5R)-1-formyl-4,6,6-trimethyl-5-bicyclo[2.1.1]hexanyl]methylthallium |
| SMILES | CC1(C)C2(C=O)CC[C@@]1(C)[C@H]2C[Tl] |
| InChI | InChI=1S/C11H17O.Tl/c1-8-10(4)5-6-11(8,7-12)9(10,2)3;/h7-8H,1,5-6H2,2-4H3;/t8-,10+,11?;/m1./s1 |
| InChIKey | QLUZZFGSRKFPRQ-RWDUMBKJSA-N |
| XLogP | 2.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|