About butane;ethene;2-methylazetidine-2-carbaldehyde
butane;ethene;2-methylazetidine-2-carbaldehyde (PubChem CID 143339554) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is butane;ethene;2-methylazetidine-2-carbaldehyde.
Molecular Properties
| Compound Name | butane;ethene;2-methylazetidine-2-carbaldehyde |
| PubChem CID | 143339554 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | butane;ethene;2-methylazetidine-2-carbaldehyde |
| SMILES | C=C.CC1(C=O)CCN1.CCCC |
| InChI | InChI=1S/C5H9NO.C4H10.C2H4/c1-5(4-7)2-3-6-5;1-3-4-2;1-2/h4,6H,2-3H2,1H3;3-4H2,1-2H3;1-2H2 |
| InChIKey | IBVAJYVXWBBMFV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane;ethene;2-methylazetidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethene;2-methylazetidine-2-carbaldehyde?
The IUPAC name of butane;ethene;2-methylazetidine-2-carbaldehyde (CID 143339554) is butane;ethene;2-methylazetidine-2-carbaldehyde.
What is the SMILES notation for butane;ethene;2-methylazetidine-2-carbaldehyde?
The canonical SMILES for butane;ethene;2-methylazetidine-2-carbaldehyde is C=C.CC1(C=O)CCN1.CCCC.
What is the InChIKey of butane;ethene;2-methylazetidine-2-carbaldehyde?
The InChIKey is IBVAJYVXWBBMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C4H10.C2H4/c1-5(4-7)2-3-6-5;1-3-4-2;1-2/h4,6H,2-3H2,1H3;3-4H2,1-2H3;1-2H2.
What are the key properties of butane;ethene;2-methylazetidine-2-carbaldehyde?
butane;ethene;2-methylazetidine-2-carbaldehyde has a molecular weight of 185.31 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethene;2-methylazetidine-2-carbaldehyde is sourced from PubChem (CID 143339554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).