About 3-(2-propyl-1,3-diazinan-2-yl)propanal
3-(2-propyl-1,3-diazinan-2-yl)propanal (PubChem CID 166921525) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-(2-propyl-1,3-diazinan-2-yl)propanal.
Molecular Properties
| Compound Name | 3-(2-propyl-1,3-diazinan-2-yl)propanal |
| PubChem CID | 166921525 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-(2-propyl-1,3-diazinan-2-yl)propanal |
| SMILES | CCCC1(CCC=O)NCCCN1 |
| InChI | InChI=1S/C10H20N2O/c1-2-5-10(6-3-9-13)11-7-4-8-12-10/h9,11-12H,2-8H2,1H3 |
| InChIKey | UCOCNMUUYGRRMB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-propyl-1,3-diazinan-2-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-propyl-1,3-diazinan-2-yl)propanal?
The IUPAC name of 3-(2-propyl-1,3-diazinan-2-yl)propanal (CID 166921525) is 3-(2-propyl-1,3-diazinan-2-yl)propanal.
What is the SMILES notation for 3-(2-propyl-1,3-diazinan-2-yl)propanal?
The canonical SMILES for 3-(2-propyl-1,3-diazinan-2-yl)propanal is CCCC1(CCC=O)NCCCN1.
What is the InChIKey of 3-(2-propyl-1,3-diazinan-2-yl)propanal?
The InChIKey is UCOCNMUUYGRRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-2-5-10(6-3-9-13)11-7-4-8-12-10/h9,11-12H,2-8H2,1H3.
What are the key properties of 3-(2-propyl-1,3-diazinan-2-yl)propanal?
3-(2-propyl-1,3-diazinan-2-yl)propanal has a molecular weight of 184.28 g/mol, XLogP of 1.04, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-propyl-1,3-diazinan-2-yl)propanal is sourced from PubChem (CID 166921525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).