C8H14OS2 — CID 101026062
3-(2-methyl-1,3-dithian-2-yl)propanal (PubChem CID 101026062) has the molecular formula C8H14OS2 and a molecular weight of 190.33 g/mol. Its IUPAC name is 3-(2-methyl-1,3-dithian-2-yl)propanal.
| Compound Name | 3-(2-methyl-1,3-dithian-2-yl)propanal |
|---|---|
| PubChem CID | 101026062 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 3-(2-methyl-1,3-dithian-2-yl)propanal |
| SMILES | CC1(CCC=O)SCCCS1 |
| InChI | InChI=1S/C8H14OS2/c1-8(4-2-5-9)10-6-3-7-11-8/h5H,2-4,6-7H2,1H3 |
| InChIKey | WKCVOXPUFXWQIY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|