C7H14N2OS2 — CID 134121241
2-(2-methyl-1,3-dithian-2-yl)acetohydrazide (PubChem CID 134121241) has the molecular formula C7H14N2OS2 and a molecular weight of 206.34 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dithian-2-yl)acetohydrazide.
| Compound Name | 2-(2-methyl-1,3-dithian-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 134121241 |
| Molecular Formula | C7H14N2OS2 |
| Molecular Weight | 206.34 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(2-methyl-1,3-dithian-2-yl)acetohydrazide |
| SMILES | CC1(CC(=O)NN)SCCCS1 |
| InChI | InChI=1S/C7H14N2OS2/c1-7(5-6(10)9-8)11-3-2-4-12-7/h2-5,8H2,1H3,(H,9,10) |
| InChIKey | GCPAZSJMBUZNAY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|