C8H15NOS2 — CID 135041200
(NE)-N-[1-(2-methyl-1,3-dithian-2-yl)propan-2-ylidene]hydroxylamine (PubChem CID 135041200) has the molecular formula C8H15NOS2 and a molecular weight of 205.35 g/mol. Its IUPAC name is (NE)-N-[1-(2-methyl-1,3-dithian-2-yl)propan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(2-methyl-1,3-dithian-2-yl)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135041200 |
| Molecular Formula | C8H15NOS2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (NE)-N-[1-(2-methyl-1,3-dithian-2-yl)propan-2-ylidene]hydroxylamine |
| SMILES | C/C(CC1(C)SCCCS1)=N\O |
| InChI | InChI=1S/C8H15NOS2/c1-7(9-10)6-8(2)11-4-3-5-12-8/h10H,3-6H2,1-2H3/b9-7+ |
| InChIKey | VJHVNPSQRWQCHG-VQHVLOKHSA-N |
| XLogP | 2.81 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|