C8H17NS2 — CID 12794253
3-(2-methyl-1,3-dithian-2-yl)propan-1-amine (PubChem CID 12794253) has the molecular formula C8H17NS2 and a molecular weight of 191.36 g/mol. Its IUPAC name is 3-(2-methyl-1,3-dithian-2-yl)propan-1-amine.
| Compound Name | 3-(2-methyl-1,3-dithian-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 12794253 |
| Molecular Formula | C8H17NS2 |
| Molecular Weight | 191.36 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 3-(2-methyl-1,3-dithian-2-yl)propan-1-amine |
| SMILES | CC1(CCCN)SCCCS1 |
| InChI | InChI=1S/C8H17NS2/c1-8(4-2-5-9)10-6-3-7-11-8/h2-7,9H2,1H3 |
| InChIKey | IDJTYRYKEWMGAQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |