C8H14O2S2 — CID 15751233
3-(2-methyl-1,3-dithian-2-yl)propanoic acid (PubChem CID 15751233) has the molecular formula C8H14O2S2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 3-(2-methyl-1,3-dithian-2-yl)propanoic acid.
| Compound Name | 3-(2-methyl-1,3-dithian-2-yl)propanoic acid |
|---|---|
| PubChem CID | 15751233 |
| Molecular Formula | C8H14O2S2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 3-(2-methyl-1,3-dithian-2-yl)propanoic acid |
| SMILES | CC1(CCC(=O)O)SCCCS1 |
| InChI | InChI=1S/C8H14O2S2/c1-8(4-3-7(9)10)11-5-2-6-12-8/h2-6H2,1H3,(H,9,10) |
| InChIKey | DXXBROLILTWQAE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |