C10H22S2 — CID 144926303
2,2-dimethyl-1,3-dithiane;2-methylpropane (PubChem CID 144926303) has the molecular formula C10H22S2 and a molecular weight of 206.42 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dithiane;2-methylpropane.
| Compound Name | 2,2-dimethyl-1,3-dithiane;2-methylpropane |
|---|---|
| PubChem CID | 144926303 |
| Molecular Formula | C10H22S2 |
| Molecular Weight | 206.42 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2,2-dimethyl-1,3-dithiane;2-methylpropane |
| SMILES | CC(C)C.CC1(C)SCCCS1 |
| InChI | InChI=1S/C6H12S2.C4H10/c1-6(2)7-4-3-5-8-6;1-4(2)3/h3-5H2,1-2H3;4H,1-3H3 |
| InChIKey | OSEFQVDXDUNGRG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |