C9H16OS2 — CID 102311898
(2R)-2-(2-ethyl-1,3-dithian-2-yl)propanal (PubChem CID 102311898) has the molecular formula C9H16OS2 and a molecular weight of 204.36 g/mol. Its IUPAC name is (2R)-2-(2-ethyl-1,3-dithian-2-yl)propanal.
| Compound Name | (2R)-2-(2-ethyl-1,3-dithian-2-yl)propanal |
|---|---|
| PubChem CID | 102311898 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (2R)-2-(2-ethyl-1,3-dithian-2-yl)propanal |
| SMILES | CCC1([C@H](C)C=O)SCCCS1 |
| InChI | InChI=1S/C9H16OS2/c1-3-9(8(2)7-10)11-5-4-6-12-9/h7-8H,3-6H2,1-2H3/t8-/m1/s1 |
| InChIKey | PPSYSDBNKZRRQF-MRVPVSSYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|