C9H15BrO2S2 — CID 10913566
(2R)-2-bromo-1-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one (PubChem CID 10913566) has the molecular formula C9H15BrO2S2 and a molecular weight of 299.25 g/mol. Its IUPAC name is (2R)-2-bromo-1-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one.
| Compound Name | (2R)-2-bromo-1-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one |
|---|---|
| PubChem CID | 10913566 |
| Molecular Formula | C9H15BrO2S2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | (2R)-2-bromo-1-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one |
| SMILES | CC[C@]1(C(=O)[C@@H](C)Br)SCCC[S@]1=O |
| InChI | InChI=1S/C9H15BrO2S2/c1-3-9(8(11)7(2)10)13-5-4-6-14(9)12/h7H,3-6H2,1-2H3/t7-,9+,14-/m1/s1 |
| InChIKey | VJONLGMWLNVODF-UKXBGOPOSA-N |
| XLogP | 2.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|