C8H14O2S2 — CID 11117232
1-[(1R,2R)-1-oxo-2-propyl-1,3-dithiolan-2-yl]ethanone (PubChem CID 11117232) has the molecular formula C8H14O2S2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[(1R,2R)-1-oxo-2-propyl-1,3-dithiolan-2-yl]ethanone.
| Compound Name | 1-[(1R,2R)-1-oxo-2-propyl-1,3-dithiolan-2-yl]ethanone |
|---|---|
| PubChem CID | 11117232 |
| Molecular Formula | C8H14O2S2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1-[(1R,2R)-1-oxo-2-propyl-1,3-dithiolan-2-yl]ethanone |
| SMILES | CCC[C@@]1(C(C)=O)SCC[S@]1=O |
| InChI | InChI=1S/C8H14O2S2/c1-3-4-8(7(2)9)11-5-6-12(8)10/h3-6H2,1-2H3/t8-,12-/m1/s1 |
| InChIKey | QFCRECQJGHFKHK-PRHODGIISA-N |
| XLogP | 1.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |