C9H16O2S2 — CID 14710453
1-[(1S,2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one (PubChem CID 14710453) has the molecular formula C9H16O2S2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-[(1S,2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one.
| Compound Name | 1-[(1S,2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one |
|---|---|
| PubChem CID | 14710453 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 1-[(1S,2R)-2-ethyl-1-oxo-1,3-dithian-2-yl]propan-1-one |
| SMILES | CCC(=O)[C@]1(CC)SCCC[S@@]1=O |
| InChI | InChI=1S/C9H16O2S2/c1-3-8(10)9(4-2)12-6-5-7-13(9)11/h3-7H2,1-2H3/t9-,13+/m1/s1 |
| InChIKey | KJTPFXJYNLWBMA-RNCFNFMXSA-N |
| XLogP | 1.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |