C8H14OS2 — CID 100920868
(2S)-2-methyl-2-prop-2-enyl-1,3-dithiane 1-oxide (PubChem CID 100920868) has the molecular formula C8H14OS2 and a molecular weight of 190.33 g/mol. Its IUPAC name is (2S)-2-methyl-2-prop-2-enyl-1,3-dithiane 1-oxide.
| Compound Name | (2S)-2-methyl-2-prop-2-enyl-1,3-dithiane 1-oxide |
|---|---|
| PubChem CID | 100920868 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (2S)-2-methyl-2-prop-2-enyl-1,3-dithiane 1-oxide |
| SMILES | C=CC[C@@]1(C)SCCCS1=O |
| InChI | InChI=1S/C8H14OS2/c1-3-5-8(2)10-6-4-7-11(8)9/h3H,1,4-7H2,2H3/t8-,11?/m0/s1 |
| InChIKey | KXWFWCGXZMSHIB-YMNIQAILSA-N |
| XLogP | 2.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|