About ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate
ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate (PubChem CID 10589916) has the molecular formula C12H22O4S2
and a molecular weight of 294.44 g/mol. Its IUPAC name is ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate.
Molecular Properties
| Compound Name | ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate |
| PubChem CID | 10589916 |
| Molecular Formula | C12H22O4S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate |
| SMILES | CCOC(=O)C[C@@](C)(O)[C@@]1(CC)SCCC[S@]1=O |
| InChI | InChI=1S/C12H22O4S2/c1-4-12(17-7-6-8-18(12)15)11(3,14)9-10(13)16-5-2/h14H,4-9H2,1-3H3/t11-,12+,18-/m1/s1 |
| InChIKey | IPLZHCLAASDPKF-FTLABTOESA-N |
| XLogP | 1.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate?
The IUPAC name of ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate (CID 10589916) is ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate.
What is the SMILES notation for ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate?
The canonical SMILES for ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate is CCOC(=O)C[C@@](C)(O)[C@@]1(CC)SCCC[S@]1=O.
What is the InChIKey of ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate?
The InChIKey is IPLZHCLAASDPKF-FTLABTOESA-N. The full InChI is InChI=1S/C12H22O4S2/c1-4-12(17-7-6-8-18(12)15)11(3,14)9-10(13)16-5-2/h14H,4-9H2,1-3H3/t11-,12+,18-/m1/s1.
What are the key properties of ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate?
ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate has a molecular weight of 294.44 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-3-[(1R,2S)-2-ethyl-1-oxo-1,3-dithian-2-yl]-3-hydroxybutanoate is sourced from PubChem (CID 10589916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).