C10H18O3S2 — CID 135055256
1-[(1R,3R)-2-ethyl-1,3-dioxo-1,3-dithian-2-yl]butan-1-one (PubChem CID 135055256) has the molecular formula C10H18O3S2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-[(1R,3R)-2-ethyl-1,3-dioxo-1,3-dithian-2-yl]butan-1-one.
| Compound Name | 1-[(1R,3R)-2-ethyl-1,3-dioxo-1,3-dithian-2-yl]butan-1-one |
|---|---|
| PubChem CID | 135055256 |
| Molecular Formula | C10H18O3S2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1-[(1R,3R)-2-ethyl-1,3-dioxo-1,3-dithian-2-yl]butan-1-one |
| SMILES | CCCC(=O)C1(CC)[S@](=O)CCC[S@]1=O |
| InChI | InChI=1S/C10H18O3S2/c1-3-6-9(11)10(4-2)14(12)7-5-8-15(10)13/h3-8H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | IWYFQZDTBQIHQM-HUUCEWRRSA-N |
| XLogP | 1.36 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |