About 1,3-dithiane-2,2-dithiol
1,3-dithiane-2,2-dithiol (PubChem CID 57493479) has the molecular formula C4H8S4
and a molecular weight of 184.38 g/mol. Its IUPAC name is 1,3-dithiane-2,2-dithiol.
Molecular Properties
| Compound Name | 1,3-dithiane-2,2-dithiol |
| PubChem CID | 57493479 |
| Molecular Formula | C4H8S4 |
| Molecular Weight | 184.38 g/mol |
| Exact Mass | 183.95 |
| IUPAC Name | 1,3-dithiane-2,2-dithiol |
| SMILES | SC1(S)SCCCS1 |
| InChI | InChI=1S/C4H8S4/c5-4(6)7-2-1-3-8-4/h5-6H,1-3H2 |
| InChIKey | WTHDIMTYOZVDNZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dithiane-2,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dithiane-2,2-dithiol?
The IUPAC name of 1,3-dithiane-2,2-dithiol (CID 57493479) is 1,3-dithiane-2,2-dithiol.
What is the SMILES notation for 1,3-dithiane-2,2-dithiol?
The canonical SMILES for 1,3-dithiane-2,2-dithiol is SC1(S)SCCCS1.
What is the InChIKey of 1,3-dithiane-2,2-dithiol?
The InChIKey is WTHDIMTYOZVDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8S4/c5-4(6)7-2-1-3-8-4/h5-6H,1-3H2.
What are the key properties of 1,3-dithiane-2,2-dithiol?
1,3-dithiane-2,2-dithiol has a molecular weight of 184.38 g/mol, XLogP of 2.33, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dithiane-2,2-dithiol is sourced from PubChem (CID 57493479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).