C4H8S4 — CID 57493479
1,3-dithiane-2,2-dithiol (PubChem CID 57493479) has the molecular formula C4H8S4 and a molecular weight of 184.38 g/mol. Its IUPAC name is 1,3-dithiane-2,2-dithiol.
| Compound Name | 1,3-dithiane-2,2-dithiol |
|---|---|
| PubChem CID | 57493479 |
| Molecular Formula | C4H8S4 |
| Molecular Weight | 184.38 g/mol |
| Exact Mass | 183.95 |
| IUPAC Name | 1,3-dithiane-2,2-dithiol |
| SMILES | SC1(S)SCCCS1 |
| InChI | InChI=1S/C4H8S4/c5-4(6)7-2-1-3-8-4/h5-6H,1-3H2 |
| InChIKey | WTHDIMTYOZVDNZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|