C13H16O2S2 — CID 101433894
4-[(2-methyl-1,3-dithian-2-yl)methoxy]benzaldehyde (PubChem CID 101433894) has the molecular formula C13H16O2S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-dithian-2-yl)methoxy]benzaldehyde.
| Compound Name | 4-[(2-methyl-1,3-dithian-2-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 101433894 |
| Molecular Formula | C13H16O2S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 4-[(2-methyl-1,3-dithian-2-yl)methoxy]benzaldehyde |
| SMILES | CC1(COc2ccc(C=O)cc2)SCCCS1 |
| InChI | InChI=1S/C13H16O2S2/c1-13(16-7-2-8-17-13)10-15-12-5-3-11(9-14)4-6-12/h3-6,9H,2,7-8,10H2,1H3 |
| InChIKey | MZCMMXXBOGFTEU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|