About methanol;2-methylpyrrolidine-2-carbaldehyde
methanol;2-methylpyrrolidine-2-carbaldehyde (PubChem CID 143757683) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is methanol;2-methylpyrrolidine-2-carbaldehyde.
Molecular Properties
| Compound Name | methanol;2-methylpyrrolidine-2-carbaldehyde |
| PubChem CID | 143757683 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | methanol;2-methylpyrrolidine-2-carbaldehyde |
| SMILES | CC1(C=O)CCCN1.CO |
| InChI | InChI=1S/C6H11NO.CH4O/c1-6(5-8)3-2-4-7-6;1-2/h5,7H,2-4H2,1H3;2H,1H3 |
| InChIKey | WEOSIZKRQFEBQQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-methylpyrrolidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methylpyrrolidine-2-carbaldehyde?
The IUPAC name of methanol;2-methylpyrrolidine-2-carbaldehyde (CID 143757683) is methanol;2-methylpyrrolidine-2-carbaldehyde.
What is the SMILES notation for methanol;2-methylpyrrolidine-2-carbaldehyde?
The canonical SMILES for methanol;2-methylpyrrolidine-2-carbaldehyde is CC1(C=O)CCCN1.CO.
What is the InChIKey of methanol;2-methylpyrrolidine-2-carbaldehyde?
The InChIKey is WEOSIZKRQFEBQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.CH4O/c1-6(5-8)3-2-4-7-6;1-2/h5,7H,2-4H2,1H3;2H,1H3.
What are the key properties of methanol;2-methylpyrrolidine-2-carbaldehyde?
methanol;2-methylpyrrolidine-2-carbaldehyde has a molecular weight of 145.20 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methylpyrrolidine-2-carbaldehyde is sourced from PubChem (CID 143757683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).