About 4-ethenylpiperidine-4-carbaldehyde;methoxyethane
4-ethenylpiperidine-4-carbaldehyde;methoxyethane (PubChem CID 170591163) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 4-ethenylpiperidine-4-carbaldehyde;methoxyethane.
Molecular Properties
| Compound Name | 4-ethenylpiperidine-4-carbaldehyde;methoxyethane |
| PubChem CID | 170591163 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 4-ethenylpiperidine-4-carbaldehyde;methoxyethane |
| SMILES | C=CC1(C=O)CCNCC1.CCOC |
| InChI | InChI=1S/C8H13NO.C3H8O/c1-2-8(7-10)3-5-9-6-4-8;1-3-4-2/h2,7,9H,1,3-6H2;3H2,1-2H3 |
| InChIKey | ROHCMGADOIITBI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylpiperidine-4-carbaldehyde;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylpiperidine-4-carbaldehyde;methoxyethane?
The IUPAC name of 4-ethenylpiperidine-4-carbaldehyde;methoxyethane (CID 170591163) is 4-ethenylpiperidine-4-carbaldehyde;methoxyethane.
What is the SMILES notation for 4-ethenylpiperidine-4-carbaldehyde;methoxyethane?
The canonical SMILES for 4-ethenylpiperidine-4-carbaldehyde;methoxyethane is C=CC1(C=O)CCNCC1.CCOC.
What is the InChIKey of 4-ethenylpiperidine-4-carbaldehyde;methoxyethane?
The InChIKey is ROHCMGADOIITBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.C3H8O/c1-2-8(7-10)3-5-9-6-4-8;1-3-4-2/h2,7,9H,1,3-6H2;3H2,1-2H3.
What are the key properties of 4-ethenylpiperidine-4-carbaldehyde;methoxyethane?
4-ethenylpiperidine-4-carbaldehyde;methoxyethane has a molecular weight of 199.29 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylpiperidine-4-carbaldehyde;methoxyethane is sourced from PubChem (CID 170591163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).