C14H19BrO2 — CID 74007443
8-bromo-3-hydroxy-6-methyl-3-prop-1-en-2-yltricyclo[4.4.0.02,8]decan-7-one (PubChem CID 74007443) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 8-bromo-3-hydroxy-6-methyl-3-prop-1-en-2-yltricyclo[4.4.0.02,8]decan-7-one.
| Compound Name | 8-bromo-3-hydroxy-6-methyl-3-prop-1-en-2-yltricyclo[4.4.0.02,8]decan-7-one |
|---|---|
| PubChem CID | 74007443 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 8-bromo-3-hydroxy-6-methyl-3-prop-1-en-2-yltricyclo[4.4.0.02,8]decan-7-one |
| SMILES | C=C(C)C1(O)CCC2(C)C(=O)C3(Br)CCC2C13 |
| InChI | InChI=1S/C14H19BrO2/c1-8(2)14(17)7-6-12(3)9-4-5-13(15,10(9)14)11(12)16/h9-10,17H,1,4-7H2,2-3H3 |
| InChIKey | VLDCQYUFMFOFNM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|