C12H22O3 — CID 118501564
(1R,2R,3S,4R,5R)-3,4,5-trimethyl-1-prop-1-en-2-ylcyclohexane-1,2,4-triol (PubChem CID 118501564) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-3,4,5-trimethyl-1-prop-1-en-2-ylcyclohexane-1,2,4-triol.
| Compound Name | (1R,2R,3S,4R,5R)-3,4,5-trimethyl-1-prop-1-en-2-ylcyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 118501564 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (1R,2R,3S,4R,5R)-3,4,5-trimethyl-1-prop-1-en-2-ylcyclohexane-1,2,4-triol |
| SMILES | C=C(C)[C@]1(O)C[C@@H](C)[C@@](C)(O)[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C12H22O3/c1-7(2)12(15)6-8(3)11(5,14)9(4)10(12)13/h8-10,13-15H,1,6H2,2-5H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | MRUWRFIZDAPQHW-IYKVGLELSA-N |
| XLogP | 1.08 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|