C10H13BrO — CID 129430868
(1S,2R,4S,6R)-2-bromo-4,5,5-trimethyltricyclo[2.2.1.02,6]heptan-3-one (PubChem CID 129430868) has the molecular formula C10H13BrO and a molecular weight of 229.12 g/mol. Its IUPAC name is (1S,2R,4S,6R)-2-bromo-4,5,5-trimethyltricyclo[2.2.1.02,6]heptan-3-one.
| Compound Name | (1S,2R,4S,6R)-2-bromo-4,5,5-trimethyltricyclo[2.2.1.02,6]heptan-3-one |
|---|---|
| PubChem CID | 129430868 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (1S,2R,4S,6R)-2-bromo-4,5,5-trimethyltricyclo[2.2.1.02,6]heptan-3-one |
| SMILES | CC1(C)[C@H]2[C@@H]3C[C@]1(C)C(=O)[C@]23Br |
| InChI | InChI=1S/C10H13BrO/c1-8(2)6-5-4-9(8,3)7(12)10(5,6)11/h5-6H,4H2,1-3H3/t5-,6+,9+,10+/m0/s1 |
| InChIKey | NFRDPHJVSHYINH-NAXOPYRSSA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|