C10H15BrO2 — CID 102425615
(1S,4S,5S)-1-bromo-4-hydroxy-3,3,6,6-tetramethylbicyclo[3.1.0]hexan-2-one (PubChem CID 102425615) has the molecular formula C10H15BrO2 and a molecular weight of 247.13 g/mol. Its IUPAC name is (1S,4S,5S)-1-bromo-4-hydroxy-3,3,6,6-tetramethylbicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,4S,5S)-1-bromo-4-hydroxy-3,3,6,6-tetramethylbicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 102425615 |
| Molecular Formula | C10H15BrO2 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (1S,4S,5S)-1-bromo-4-hydroxy-3,3,6,6-tetramethylbicyclo[3.1.0]hexan-2-one |
| SMILES | CC1(C)C(=O)[C@]2(Br)[C@H]([C@@H]1O)C2(C)C |
| InChI | InChI=1S/C10H15BrO2/c1-8(2)6(12)5-9(3,4)10(5,11)7(8)13/h5-6,12H,1-4H3/t5-,6+,10-/m1/s1 |
| InChIKey | FAAYJVKMOKMAKW-GOZTUDAPSA-N |
| XLogP | 1.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|