C14H23NO4 — CID 137402707
5-hydroxy-6-[(E)-N-hydroxy-C-propan-2-ylcarbonimidoyl]-2,2,4,4-tetramethylcyclohexane-1,3-dione (PubChem CID 137402707) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 5-hydroxy-6-[(E)-N-hydroxy-C-propan-2-ylcarbonimidoyl]-2,2,4,4-tetramethylcyclohexane-1,3-dione.
| Compound Name | 5-hydroxy-6-[(E)-N-hydroxy-C-propan-2-ylcarbonimidoyl]-2,2,4,4-tetramethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 137402707 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 5-hydroxy-6-[(E)-N-hydroxy-C-propan-2-ylcarbonimidoyl]-2,2,4,4-tetramethylcyclohexane-1,3-dione |
| SMILES | CC(C)/C(=N\O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1O |
| InChI | InChI=1S/C14H23NO4/c1-7(2)9(15-19)8-10(16)13(3,4)12(18)14(5,6)11(8)17/h7-8,10,16,19H,1-6H3/b15-9+ |
| InChIKey | NPOHBRJOBOKAIP-OQLLNIDSSA-N |
| XLogP | 1.65 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|