C15H24O4 — CID 59518430
6-(1-hydroxy-3-methylbutyl)-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 59518430) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 6-(1-hydroxy-3-methylbutyl)-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-(1-hydroxy-3-methylbutyl)-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 59518430 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 6-(1-hydroxy-3-methylbutyl)-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CC(C)CC(O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C15H24O4/c1-8(2)7-9(16)10-11(17)14(3,4)13(19)15(5,6)12(10)18/h8-10,16H,7H2,1-6H3 |
| InChIKey | QULNWSCBVFUVOI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|