C16H25NO2 — CID 59996055
2-methyl-N-(3,3,5,5-tetramethyl-2,6-dimethylidene-4-oxocyclohexyl)propanamide (PubChem CID 59996055) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-methyl-N-(3,3,5,5-tetramethyl-2,6-dimethylidene-4-oxocyclohexyl)propanamide.
| Compound Name | 2-methyl-N-(3,3,5,5-tetramethyl-2,6-dimethylidene-4-oxocyclohexyl)propanamide |
|---|---|
| PubChem CID | 59996055 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-methyl-N-(3,3,5,5-tetramethyl-2,6-dimethylidene-4-oxocyclohexyl)propanamide |
| SMILES | C=C1C(NC(=O)C(C)C)C(=C)C(C)(C)C(=O)C1(C)C |
| InChI | InChI=1S/C16H25NO2/c1-9(2)13(18)17-12-10(3)15(5,6)14(19)16(7,8)11(12)4/h9,12H,3-4H2,1-2,5-8H3,(H,17,18) |
| InChIKey | PDTVCMMWZUSPDE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|