C9H8N2O4 — CID 71358860
3,7-diazatricyclo[3.3.3.01,5]undecane-2,4,6,8-tetrone (PubChem CID 71358860) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 3,7-diazatricyclo[3.3.3.01,5]undecane-2,4,6,8-tetrone.
| Compound Name | 3,7-diazatricyclo[3.3.3.01,5]undecane-2,4,6,8-tetrone |
|---|---|
| PubChem CID | 71358860 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3,7-diazatricyclo[3.3.3.01,5]undecane-2,4,6,8-tetrone |
| SMILES | O=C1NC(=O)C23CCCC12C(=O)NC3=O |
| InChI | InChI=1S/C9H8N2O4/c12-4-8-2-1-3-9(8,6(14)10-4)7(15)11-5(8)13/h1-3H2,(H,10,12,14)(H,11,13,15) |
| InChIKey | YKVOUQFSWYXRSC-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|