C13H13N3O2 — CID 8607229
(1S,5R)-2,4-dioxospiro[3-azabicyclo[3.1.0]hexane-6,1'-cycloheptane]-1,5-dicarbonitrile (PubChem CID 8607229) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is (1S,5R)-2,4-dioxospiro[3-azabicyclo[3.1.0]hexane-6,1'-cycloheptane]-1,5-dicarbonitrile.
| Compound Name | (1S,5R)-2,4-dioxospiro[3-azabicyclo[3.1.0]hexane-6,1'-cycloheptane]-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 8607229 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (1S,5R)-2,4-dioxospiro[3-azabicyclo[3.1.0]hexane-6,1'-cycloheptane]-1,5-dicarbonitrile |
| SMILES | N#C[C@@]12C(=O)NC(=O)[C@]1(C#N)C21CCCCCC1 |
| InChI | InChI=1S/C13H13N3O2/c14-7-12-9(17)16-10(18)13(12,8-15)11(12)5-3-1-2-4-6-11/h1-6H2,(H,16,17,18)/t12-,13+ |
| InChIKey | UUIAJIGPFPTWTF-BETUJISGSA-N |
| XLogP | 1.02 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|