C6H7NO2S — CID 137401816
5-thia-7-azaspiro[3.4]octane-6,8-dione (PubChem CID 137401816) has the molecular formula C6H7NO2S and a molecular weight of 157.19 g/mol. Its IUPAC name is 5-thia-7-azaspiro[3.4]octane-6,8-dione.
| Compound Name | 5-thia-7-azaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 137401816 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 5-thia-7-azaspiro[3.4]octane-6,8-dione |
| SMILES | O=C1NC(=O)C2(CCC2)S1 |
| InChI | InChI=1S/C6H7NO2S/c8-4-6(2-1-3-6)10-5(9)7-4/h1-3H2,(H,7,8,9) |
| InChIKey | OOMOYKKDQLBUBJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|