About 5-thia-7-azaspiro[3.4]octane-6,8-dione
5-thia-7-azaspiro[3.4]octane-6,8-dione (PubChem CID 137401816) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is 5-thia-7-azaspiro[3.4]octane-6,8-dione.
Molecular Properties
| Compound Name | 5-thia-7-azaspiro[3.4]octane-6,8-dione |
| PubChem CID | 137401816 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 5-thia-7-azaspiro[3.4]octane-6,8-dione |
| SMILES | O=C1NC(=O)C2(CCC2)S1 |
| InChI | InChI=1S/C6H7NO2S/c8-4-6(2-1-3-6)10-5(9)7-4/h1-3H2,(H,7,8,9) |
| InChIKey | OOMOYKKDQLBUBJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-thia-7-azaspiro[3.4]octane-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-thia-7-azaspiro[3.4]octane-6,8-dione?
The IUPAC name of 5-thia-7-azaspiro[3.4]octane-6,8-dione (CID 137401816) is 5-thia-7-azaspiro[3.4]octane-6,8-dione.
What is the SMILES notation for 5-thia-7-azaspiro[3.4]octane-6,8-dione?
The canonical SMILES for 5-thia-7-azaspiro[3.4]octane-6,8-dione is O=C1NC(=O)C2(CCC2)S1.
What is the InChIKey of 5-thia-7-azaspiro[3.4]octane-6,8-dione?
The InChIKey is OOMOYKKDQLBUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c8-4-6(2-1-3-6)10-5(9)7-4/h1-3H2,(H,7,8,9).
What are the key properties of 5-thia-7-azaspiro[3.4]octane-6,8-dione?
5-thia-7-azaspiro[3.4]octane-6,8-dione has a molecular weight of 157.19 g/mol, XLogP of 0.89, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-thia-7-azaspiro[3.4]octane-6,8-dione is sourced from PubChem (CID 137401816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).