C12H13NO2S — CID 115097235
8-methoxyspiro[4H-1,4-benzothiazine-2,1'-cyclobutane]-3-one (PubChem CID 115097235) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 8-methoxyspiro[4H-1,4-benzothiazine-2,1'-cyclobutane]-3-one.
| Compound Name | 8-methoxyspiro[4H-1,4-benzothiazine-2,1'-cyclobutane]-3-one |
|---|---|
| PubChem CID | 115097235 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 8-methoxyspiro[4H-1,4-benzothiazine-2,1'-cyclobutane]-3-one |
| SMILES | COc1cccc2c1SC1(CCC1)C(=O)N2 |
| InChI | InChI=1S/C12H13NO2S/c1-15-9-5-2-4-8-10(9)16-12(6-3-7-12)11(14)13-8/h2,4-5H,3,6-7H2,1H3,(H,13,14) |
| InChIKey | YTFQGEFWSIFROV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |