C9H15NO2S — CID 71323446
5,5-dipropyl-1,3-thiazolidine-2,4-dione (PubChem CID 71323446) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 5,5-dipropyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5,5-dipropyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 71323446 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 5,5-dipropyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCC1(CCC)SC(=O)NC1=O |
| InChI | InChI=1S/C9H15NO2S/c1-3-5-9(6-4-2)7(11)10-8(12)13-9/h3-6H2,1-2H3,(H,10,11,12) |
| InChIKey | MALPXCBPFJKRKQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|