C13H16F2N2OS — CID 136595576
2-[[(5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]imino]-1-thia-3-azaspiro[4.4]nonan-4-one (PubChem CID 136595576) has the molecular formula C13H16F2N2OS and a molecular weight of 286.35 g/mol. Its IUPAC name is 2-[[(5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]imino]-1-thia-3-azaspiro[4.4]nonan-4-one.
| Compound Name | 2-[[(5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]imino]-1-thia-3-azaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 136595576 |
| Molecular Formula | C13H16F2N2OS |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[[(5S)-6,6-difluoro-3-bicyclo[3.1.0]hexanyl]imino]-1-thia-3-azaspiro[4.4]nonan-4-one |
| SMILES | O=C1N/C(=N/C2CC3[C@H](C2)C3(F)F)SC12CCCC2 |
| InChI | InChI=1S/C13H16F2N2OS/c14-13(15)8-5-7(6-9(8)13)16-11-17-10(18)12(19-11)3-1-2-4-12/h7-9H,1-6H2,(H,16,17,18)/t7?,8-,9?/m0/s1 |
| InChIKey | JMJCYSOOSXBHOV-MGURRDGZSA-N |
| XLogP | 2.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|