C15H20N3OPS — CID 143468638
(2E)-8-amino-2-(7-phosphabicyclo[4.2.0]octa-1,5-dien-7-ylimino)-1-thia-3-azaspiro[4.5]decan-4-one (PubChem CID 143468638) has the molecular formula C15H20N3OPS and a molecular weight of 321.39 g/mol. Its IUPAC name is (2E)-8-amino-2-(7-phosphabicyclo[4.2.0]octa-1,5-dien-7-ylimino)-1-thia-3-azaspiro[4.5]decan-4-one.
| Compound Name | (2E)-8-amino-2-(7-phosphabicyclo[4.2.0]octa-1,5-dien-7-ylimino)-1-thia-3-azaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 143468638 |
| Molecular Formula | C15H20N3OPS |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (2E)-8-amino-2-(7-phosphabicyclo[4.2.0]octa-1,5-dien-7-ylimino)-1-thia-3-azaspiro[4.5]decan-4-one |
| SMILES | NC1CCC2(CC1)S/C(=N/P1CC3=CCCC=C31)NC2=O |
| InChI | InChI=1S/C15H20N3OPS/c16-11-5-7-15(8-6-11)13(19)17-14(21-15)18-20-9-10-3-1-2-4-12(10)20/h3-4,11H,1-2,5-9,16H2,(H,17,18,19) |
| InChIKey | GFDOBLPKKNDEJE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|