C17H28N2OS — CID 136595559
2-[1-(3,5-dimethylcyclohexyl)ethylimino]-1-thia-3-azaspiro[4.4]nonan-4-one (PubChem CID 136595559) has the molecular formula C17H28N2OS and a molecular weight of 308.49 g/mol. Its IUPAC name is 2-[1-(3,5-dimethylcyclohexyl)ethylimino]-1-thia-3-azaspiro[4.4]nonan-4-one.
| Compound Name | 2-[1-(3,5-dimethylcyclohexyl)ethylimino]-1-thia-3-azaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 136595559 |
| Molecular Formula | C17H28N2OS |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-[1-(3,5-dimethylcyclohexyl)ethylimino]-1-thia-3-azaspiro[4.4]nonan-4-one |
| SMILES | CC1CC(C)CC(C(C)/N=C2/NC(=O)C3(CCCC3)S2)C1 |
| InChI | InChI=1S/C17H28N2OS/c1-11-8-12(2)10-14(9-11)13(3)18-16-19-15(20)17(21-16)6-4-5-7-17/h11-14H,4-10H2,1-3H3,(H,18,19,20) |
| InChIKey | STQKIDPAFQKDOW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|