C14H18F2N2OS — CID 135989578
2-[(6,6-difluoro-2-bicyclo[2.2.1]heptanyl)imino]-1-thia-3-azaspiro[4.4]nonan-4-one (PubChem CID 135989578) has the molecular formula C14H18F2N2OS and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-[(6,6-difluoro-2-bicyclo[2.2.1]heptanyl)imino]-1-thia-3-azaspiro[4.4]nonan-4-one.
| Compound Name | 2-[(6,6-difluoro-2-bicyclo[2.2.1]heptanyl)imino]-1-thia-3-azaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 135989578 |
| Molecular Formula | C14H18F2N2OS |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[(6,6-difluoro-2-bicyclo[2.2.1]heptanyl)imino]-1-thia-3-azaspiro[4.4]nonan-4-one |
| SMILES | O=C1N/C(=N/C2CC3CC2C(F)(F)C3)SC12CCCC2 |
| InChI | InChI=1S/C14H18F2N2OS/c15-14(16)7-8-5-9(14)10(6-8)17-12-18-11(19)13(20-12)3-1-2-4-13/h8-10H,1-7H2,(H,17,18,19) |
| InChIKey | RQBHSPHOVMUCQX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|