C26H36N4O4S2 — CID 158700064
(5S)-5-acetyl-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-1,3-thiazolidin-4-one;(5R)-5-acetyl-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-1,3-thiazolidin-4-one (PubChem CID 158700064) has the molecular formula C26H36N4O4S2 and a molecular weight of 532.73 g/mol. Its IUPAC name is (5S)-5-acetyl-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-1,3-thiazolidin-4-one;(5R)-5-acetyl-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-acetyl-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-1,3-thiazolidin-4-one;(5R)-5-acetyl-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 158700064 |
| Molecular Formula | C26H36N4O4S2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (5S)-5-acetyl-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-1,3-thiazolidin-4-one;(5R)-5-acetyl-2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-1,3-thiazolidin-4-one |
| SMILES | CC(=O)[C@@]1(C)S/C(=N\[C@H]2C[C@@H]3CC[C@H]2C3)NC1=O.CC(=O)[C@]1(C)S/C(=N\[C@H]2C[C@@H]3CC[C@H]2C3)NC1=O |
| InChI | InChI=1S/2C13H18N2O2S/c2*1-7(16)13(2)11(17)15-12(18-13)14-10-6-8-3-4-9(10)5-8/h2*8-10H,3-6H2,1-2H3,(H,14,15,17)/t8-,9+,10+,13+;8-,9+,10+,13-/m11/s1 |
| InChIKey | IHKVUMKHVYFLGS-UFZZODQCSA-N |
| XLogP | 3.48 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|