C17H26N2O2S — CID 135989120
2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-(oxan-4-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 135989120) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-(oxan-4-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-(oxan-4-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989120 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]imino]-5-methyl-5-(oxan-4-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CC1(CC2CCOCC2)S/C(=N\[C@H]2C[C@@H]3CC[C@H]2C3)NC1=O |
| InChI | InChI=1S/C17H26N2O2S/c1-17(10-11-4-6-21-7-5-11)15(20)19-16(22-17)18-14-9-12-2-3-13(14)8-12/h11-14H,2-10H2,1H3,(H,18,19,20)/t12-,13+,14+,17?/m1/s1 |
| InChIKey | QSDFLOWHPNTKRK-MDVAVASXSA-N |
| XLogP | 2.97 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|