C14H19F2N2OPS — CID 143468510
5-(2,2-difluoro-2-phosphanylethyl)-5-methyl-2-(4-tricyclo[4.2.0.01,3]octanylimino)-1,3-thiazolidin-4-one (PubChem CID 143468510) has the molecular formula C14H19F2N2OPS and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-(2,2-difluoro-2-phosphanylethyl)-5-methyl-2-(4-tricyclo[4.2.0.01,3]octanylimino)-1,3-thiazolidin-4-one.
| Compound Name | 5-(2,2-difluoro-2-phosphanylethyl)-5-methyl-2-(4-tricyclo[4.2.0.01,3]octanylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143468510 |
| Molecular Formula | C14H19F2N2OPS |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 5-(2,2-difluoro-2-phosphanylethyl)-5-methyl-2-(4-tricyclo[4.2.0.01,3]octanylimino)-1,3-thiazolidin-4-one |
| SMILES | CC1(CC(F)(F)P)S/C(=N\C2CC3CCC34CC24)NC1=O |
| InChI | InChI=1S/C14H19F2N2OPS/c1-12(6-14(15,16)20)10(19)18-11(21-12)17-9-4-7-2-3-13(7)5-8(9)13/h7-9H,2-6,20H2,1H3,(H,17,18,19) |
| InChIKey | APEYLNZAVDJZAG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|