C19H24F3N3O2S — CID 162551173
5-methyl-2-[[(4S,6S)-4-tricyclo[4.1.0.01,3]heptanyl]imino]-5-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]-1,3-thiazolidin-4-one (PubChem CID 162551173) has the molecular formula C19H24F3N3O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is 5-methyl-2-[[(4S,6S)-4-tricyclo[4.1.0.01,3]heptanyl]imino]-5-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]-1,3-thiazolidin-4-one.
| Compound Name | 5-methyl-2-[[(4S,6S)-4-tricyclo[4.1.0.01,3]heptanyl]imino]-5-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 162551173 |
| Molecular Formula | C19H24F3N3O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-methyl-2-[[(4S,6S)-4-tricyclo[4.1.0.01,3]heptanyl]imino]-5-[1-(3,3,3-trifluoropropanoyl)piperidin-4-yl]-1,3-thiazolidin-4-one |
| SMILES | CC1(C2CCN(C(=O)CC(F)(F)F)CC2)S/C(=N\[C@H]2C[C@@H]3CC34CC24)NC1=O |
| InChI | InChI=1S/C19H24F3N3O2S/c1-17(10-2-4-25(5-3-10)14(26)9-19(20,21)22)15(27)24-16(28-17)23-13-6-11-7-18(11)8-12(13)18/h10-13H,2-9H2,1H3,(H,23,24,27)/t11-,12?,13+,17?,18?/m1/s1 |
| InChIKey | KOGLSBCVMFNYGW-SMVFDCOOSA-N |
| XLogP | 2.95 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|