C13H17F5N2OS — CID 135989738
2-(5,5-difluorocyclooctyl)imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one (PubChem CID 135989738) has the molecular formula C13H17F5N2OS and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-(5,5-difluorocyclooctyl)imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(5,5-difluorocyclooctyl)imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135989738 |
| Molecular Formula | C13H17F5N2OS |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-(5,5-difluorocyclooctyl)imino-5-methyl-5-(trifluoromethyl)-1,3-thiazolidin-4-one |
| SMILES | CC1(C(F)(F)F)S/C(=N/C2CCCC(F)(F)CCC2)NC1=O |
| InChI | InChI=1S/C13H17F5N2OS/c1-11(13(16,17)18)9(21)20-10(22-11)19-8-4-2-6-12(14,15)7-3-5-8/h8H,2-7H2,1H3,(H,19,20,21) |
| InChIKey | VMVAHZWSFGHSEK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|